C13H18O4 — CID 54189960
(2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxyoxan-4-ol (PubChem CID 54189960) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxyoxan-4-ol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 54189960 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxyoxan-4-ol |
| SMILES | OC[C@H]1OCC[C@@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H18O4/c14-8-12-13(11(15)6-7-16-12)17-9-10-4-2-1-3-5-10/h1-5,11-15H,6-9H2/t11-,12-,13-/m1/s1 |
| InChIKey | PHUVXDVROBOFTH-JHJVBQTASA-N |
| XLogP | 0.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |