C20H25NO4 — CID 163725774
[(3S)-5-amino-3,4-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 163725774) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(3S)-5-amino-3,4-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3S)-5-amino-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 163725774 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(3S)-5-amino-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | NC1COC(CO)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C20H25NO4/c21-17-14-23-18(11-22)20(25-13-16-9-5-2-6-10-16)19(17)24-12-15-7-3-1-4-8-15/h1-10,17-20,22H,11-14,21H2/t17?,18?,19?,20-/m1/s1 |
| InChIKey | KVLFHYLHSBEPPG-YSFGRKDWSA-N |
| XLogP | 1.88 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |