C13H20N2O3 — CID 131227318
[(2S,3S,5R,6S)-3,5-diamino-6-phenylmethoxyoxan-2-yl]methanol (PubChem CID 131227318) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(2S,3S,5R,6S)-3,5-diamino-6-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(2S,3S,5R,6S)-3,5-diamino-6-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 131227318 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [(2S,3S,5R,6S)-3,5-diamino-6-phenylmethoxyoxan-2-yl]methanol |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](CO)O[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O3/c14-10-6-11(15)13(18-12(10)7-16)17-8-9-4-2-1-3-5-9/h1-5,10-13,16H,6-8,14-15H2/t10-,11+,12+,13-/m0/s1 |
| InChIKey | NLMIGIGPOANOFI-LOWDOPEQSA-N |
| XLogP | -0.03 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |