C16H24O3 — CID 174153826
[(3R,4R,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl]methanol (PubChem CID 174153826) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl]methanol.
| Compound Name | [(3R,4R,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl]methanol |
|---|---|
| PubChem CID | 174153826 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(3R,4R,5S,6R)-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl]methanol |
| SMILES | CC[C@H]1OC[C@@H](CO)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C16H24O3/c1-3-15-12(2)16(14(9-17)11-18-15)19-10-13-7-5-4-6-8-13/h4-8,12,14-17H,3,9-11H2,1-2H3/t12-,14+,15+,16-/m0/s1 |
| InChIKey | JJBHWSGKNOCIAG-XZDPQHSOSA-N |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |