C15H22O3 — CID 70592950
(2S,4R,5R)-2,4-diethyl-5-phenylmethoxy-1,3-dioxane (PubChem CID 70592950) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,4R,5R)-2,4-diethyl-5-phenylmethoxy-1,3-dioxane.
| Compound Name | (2S,4R,5R)-2,4-diethyl-5-phenylmethoxy-1,3-dioxane |
|---|---|
| PubChem CID | 70592950 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,4R,5R)-2,4-diethyl-5-phenylmethoxy-1,3-dioxane |
| SMILES | CC[C@H]1OC[C@@H](OCc2ccccc2)[C@@H](CC)O1 |
| InChI | InChI=1S/C15H22O3/c1-3-13-14(11-17-15(4-2)18-13)16-10-12-8-6-5-7-9-12/h5-9,13-15H,3-4,10-11H2,1-2H3/t13-,14-,15+/m1/s1 |
| InChIKey | YOTWAXDYMZZBCQ-KFWWJZLASA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |