C56H64O10 — CID 10941970
2-[2-[(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-[2-(2-phenylmethoxyethoxy)ethoxy]cyclohexyl]oxyethoxy]ethoxymethylbenzene (PubChem CID 10941970) has the molecular formula C56H64O10 and a molecular weight of 897.12 g/mol. Its IUPAC name is 2-[2-[(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-[2-(2-phenylmethoxyethoxy)ethoxy]cyclohexyl]oxyethoxy]ethoxymethylbenzene.
| Compound Name | 2-[2-[(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-[2-(2-phenylmethoxyethoxy)ethoxy]cyclohexyl]oxyethoxy]ethoxymethylbenzene |
|---|---|
| PubChem CID | 10941970 |
| Molecular Formula | C56H64O10 |
| Molecular Weight | 897.12 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | 2-[2-[(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-[2-(2-phenylmethoxyethoxy)ethoxy]cyclohexyl]oxyethoxy]ethoxymethylbenzene |
| SMILES | c1ccc(COCCOCCO[C@@H]2[C@H](OCCOCCOCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C56H64O10/c1-7-19-45(20-8-1)39-59-33-31-57-35-37-61-51-52(62-38-36-58-32-34-60-40-46-21-9-2-10-22-46)54(64-42-48-25-13-4-14-26-48)56(66-44-50-29-17-6-18-30-50)55(65-43-49-27-15-5-16-28-49)53(51)63-41-47-23-11-3-12-24-47/h1-30,51-56H,31-44H2/t51-,52+,53-,54-,55+,56+/m0/s1 |
| InChIKey | RDCBQBRQZWNZSI-OIWMUXNUSA-N |
| XLogP | 9.58 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.12 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|