C35H34O4 — CID 170424383
(2R,3R,4R)-5-(2-phenylethynyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 170424383) has the molecular formula C35H34O4 and a molecular weight of 518.65 g/mol. Its IUPAC name is (2R,3R,4R)-5-(2-phenylethynyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4R)-5-(2-phenylethynyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 170424383 |
| Molecular Formula | C35H34O4 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2R,3R,4R)-5-(2-phenylethynyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | C(#CC1CO[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H34O4/c1-5-13-28(14-6-1)21-22-32-26-37-33(27-36-23-29-15-7-2-8-16-29)35(39-25-31-19-11-4-12-20-31)34(32)38-24-30-17-9-3-10-18-30/h1-20,32-35H,23-27H2/t32?,33-,34-,35+/m1/s1 |
| InChIKey | OJHITXVYCZJDTC-USIWSXFOSA-N |
| XLogP | 6.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|