C19H28O4 — CID 135033476
(4aR,6S,8R,10aS)-6-(2-phenylmethoxyethyl)-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocin-8-ol (PubChem CID 135033476) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4aR,6S,8R,10aS)-6-(2-phenylmethoxyethyl)-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocin-8-ol.
| Compound Name | (4aR,6S,8R,10aS)-6-(2-phenylmethoxyethyl)-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocin-8-ol |
|---|---|
| PubChem CID | 135033476 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (4aR,6S,8R,10aS)-6-(2-phenylmethoxyethyl)-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocin-8-ol |
| SMILES | O[C@@H]1CC[C@@H]2OCCC[C@H]2O[C@@H](CCOCc2ccccc2)C1 |
| InChI | InChI=1S/C19H28O4/c20-16-8-9-18-19(7-4-11-22-18)23-17(13-16)10-12-21-14-15-5-2-1-3-6-15/h1-3,5-6,16-20H,4,7-14H2/t16-,17+,18+,19-/m1/s1 |
| InChIKey | JWGWQVBLGKMUCA-YDZRNGNQSA-N |
| XLogP | 3.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|