C21H26O3Se — CID 102112656
(2R,3R)-2-[(1S)-3-phenylmethoxy-1-phenylselanylpropyl]oxan-3-ol (PubChem CID 102112656) has the molecular formula C21H26O3Se and a molecular weight of 405.40 g/mol. Its IUPAC name is (2R,3R)-2-[(1S)-3-phenylmethoxy-1-phenylselanylpropyl]oxan-3-ol.
| Compound Name | (2R,3R)-2-[(1S)-3-phenylmethoxy-1-phenylselanylpropyl]oxan-3-ol |
|---|---|
| PubChem CID | 102112656 |
| Molecular Formula | C21H26O3Se |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (2R,3R)-2-[(1S)-3-phenylmethoxy-1-phenylselanylpropyl]oxan-3-ol |
| SMILES | O[C@@H]1CCCO[C@H]1[C@H](CCOCc1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C21H26O3Se/c22-19-12-7-14-24-21(19)20(25-18-10-5-2-6-11-18)13-15-23-16-17-8-3-1-4-9-17/h1-6,8-11,19-22H,7,12-16H2/t19-,20+,21-/m1/s1 |
| InChIKey | LPXRJRAVWKOJJF-QHAWAJNXSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|