C16H26O4 — CID 156747530
2-(2-phenylmethoxyethyl)oxolane;propane-2,2-diol (PubChem CID 156747530) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-(2-phenylmethoxyethyl)oxolane;propane-2,2-diol.
| Compound Name | 2-(2-phenylmethoxyethyl)oxolane;propane-2,2-diol |
|---|---|
| PubChem CID | 156747530 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-(2-phenylmethoxyethyl)oxolane;propane-2,2-diol |
| SMILES | CC(C)(O)O.c1ccc(COCCC2CCCO2)cc1 |
| InChI | InChI=1S/C13H18O2.C3H8O2/c1-2-5-12(6-3-1)11-14-10-8-13-7-4-9-15-13;1-3(2,4)5/h1-3,5-6,13H,4,7-11H2;4-5H,1-2H3 |
| InChIKey | REESFCKUPBXRRD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|