C13H18O2S — CID 14206189
2-(phenylmethoxymethyl)oxane-3-thiol (PubChem CID 14206189) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-(phenylmethoxymethyl)oxane-3-thiol.
| Compound Name | 2-(phenylmethoxymethyl)oxane-3-thiol |
|---|---|
| PubChem CID | 14206189 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(phenylmethoxymethyl)oxane-3-thiol |
| SMILES | SC1CCCOC1COCc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c16-13-7-4-8-15-12(13)10-14-9-11-5-2-1-3-6-11/h1-3,5-6,12-13,16H,4,7-10H2 |
| InChIKey | WHPGOEYBYOIMTK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|