C21H28O6 — CID 11143306
(3R,4aS,8aR)-3-[(2R,3S)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one (PubChem CID 11143306) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3R,4aS,8aR)-3-[(2R,3S)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one.
| Compound Name | (3R,4aS,8aR)-3-[(2R,3S)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 11143306 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3R,4aS,8aR)-3-[(2R,3S)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-2-one |
| SMILES | O=C1O[C@@H]2CCCO[C@H]2C[C@H]1O[C@H]1CCCO[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H28O6/c22-21-19(12-18-16(27-21)8-4-10-24-18)26-17-9-5-11-25-20(17)14-23-13-15-6-2-1-3-7-15/h1-3,6-7,16-20H,4-5,8-14H2/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | FQKSQQPDPQIHMF-LCWAXJCOSA-N |
| XLogP | 2.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |