About 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane
2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane (PubChem CID 142450312) has the molecular formula C14H30O5
and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane.
Molecular Properties
| Compound Name | 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane |
| PubChem CID | 142450312 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane |
| SMILES | COC(C)(C)O.COC(C)(C)OCCC1CCCO1 |
| InChI | InChI=1S/C10H20O3.C4H10O2/c1-10(2,11-3)13-8-6-9-5-4-7-12-9;1-4(2,5)6-3/h9H,4-8H2,1-3H3;5H,1-3H3 |
| InChIKey | XOZZRDUFOXVPPH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane?
The IUPAC name of 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane (CID 142450312) is 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane.
What is the SMILES notation for 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane?
The canonical SMILES for 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane is COC(C)(C)O.COC(C)(C)OCCC1CCCO1.
What is the InChIKey of 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane?
The InChIKey is XOZZRDUFOXVPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3.C4H10O2/c1-10(2,11-3)13-8-6-9-5-4-7-12-9;1-4(2,5)6-3/h9H,4-8H2,1-3H3;5H,1-3H3.
What are the key properties of 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane?
2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane has a molecular weight of 278.39 g/mol, XLogP of 2.32, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropan-2-ol;2-[2-(2-methoxypropan-2-yloxy)ethyl]oxolane is sourced from PubChem (CID 142450312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).