C23H30O5 — CID 122207088
(2R,3S,6R,7S)-2-(hydroxymethyl)-6-phenylmethoxy-7-(2-phenylmethoxyethyl)oxepan-3-ol (PubChem CID 122207088) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2R,3S,6R,7S)-2-(hydroxymethyl)-6-phenylmethoxy-7-(2-phenylmethoxyethyl)oxepan-3-ol.
| Compound Name | (2R,3S,6R,7S)-2-(hydroxymethyl)-6-phenylmethoxy-7-(2-phenylmethoxyethyl)oxepan-3-ol |
|---|---|
| PubChem CID | 122207088 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R,3S,6R,7S)-2-(hydroxymethyl)-6-phenylmethoxy-7-(2-phenylmethoxyethyl)oxepan-3-ol |
| SMILES | OC[C@H]1O[C@@H](CCOCc2ccccc2)[C@H](OCc2ccccc2)CC[C@@H]1O |
| InChI | InChI=1S/C23H30O5/c24-15-23-20(25)11-12-21(27-17-19-9-5-2-6-10-19)22(28-23)13-14-26-16-18-7-3-1-4-8-18/h1-10,20-25H,11-17H2/t20-,21+,22-,23+/m0/s1 |
| InChIKey | WPLDTWWJGGMYNB-GSPCLOLRSA-N |
| XLogP | 3.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|