C21H26O5 — CID 135024175
(2R,4S,6R)-2-(4-hydroxy-3-methoxyphenyl)-6-(2-phenylmethoxyethyl)oxan-4-ol (PubChem CID 135024175) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2R,4S,6R)-2-(4-hydroxy-3-methoxyphenyl)-6-(2-phenylmethoxyethyl)oxan-4-ol.
| Compound Name | (2R,4S,6R)-2-(4-hydroxy-3-methoxyphenyl)-6-(2-phenylmethoxyethyl)oxan-4-ol |
|---|---|
| PubChem CID | 135024175 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2R,4S,6R)-2-(4-hydroxy-3-methoxyphenyl)-6-(2-phenylmethoxyethyl)oxan-4-ol |
| SMILES | COc1cc([C@H]2C[C@@H](O)C[C@@H](CCOCc3ccccc3)O2)ccc1O |
| InChI | InChI=1S/C21H26O5/c1-24-21-11-16(7-8-19(21)23)20-13-17(22)12-18(26-20)9-10-25-14-15-5-3-2-4-6-15/h2-8,11,17-18,20,22-23H,9-10,12-14H2,1H3/t17-,18+,20+/m0/s1 |
| InChIKey | WOTDSCDWPXBQQV-NLWGTHIKSA-N |
| XLogP | 3.59 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|