C17H25IO4 — CID 50915847
(2R,4R,6R)-2-(iodomethyl)-4-(methoxymethoxy)-6-(2-phenylmethoxyethyl)oxane (PubChem CID 50915847) has the molecular formula C17H25IO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is (2R,4R,6R)-2-(iodomethyl)-4-(methoxymethoxy)-6-(2-phenylmethoxyethyl)oxane.
| Compound Name | (2R,4R,6R)-2-(iodomethyl)-4-(methoxymethoxy)-6-(2-phenylmethoxyethyl)oxane |
|---|---|
| PubChem CID | 50915847 |
| Molecular Formula | C17H25IO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (2R,4R,6R)-2-(iodomethyl)-4-(methoxymethoxy)-6-(2-phenylmethoxyethyl)oxane |
| SMILES | COCO[C@@H]1C[C@@H](CCOCc2ccccc2)O[C@@H](CI)C1 |
| InChI | InChI=1S/C17H25IO4/c1-19-13-21-16-9-15(22-17(10-16)11-18)7-8-20-12-14-5-3-2-4-6-14/h2-6,15-17H,7-13H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | NTWWUUNYSGGAOO-BRWVUGGUSA-N |
| XLogP | 3.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|