C25H34O7 — CID 135024177
(2R,4R,6R)-4-(methoxymethoxy)-2-[3-methoxy-4-(methoxymethoxy)phenyl]-6-(2-phenylmethoxyethyl)oxane (PubChem CID 135024177) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R,4R,6R)-4-(methoxymethoxy)-2-[3-methoxy-4-(methoxymethoxy)phenyl]-6-(2-phenylmethoxyethyl)oxane.
| Compound Name | (2R,4R,6R)-4-(methoxymethoxy)-2-[3-methoxy-4-(methoxymethoxy)phenyl]-6-(2-phenylmethoxyethyl)oxane |
|---|---|
| PubChem CID | 135024177 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (2R,4R,6R)-4-(methoxymethoxy)-2-[3-methoxy-4-(methoxymethoxy)phenyl]-6-(2-phenylmethoxyethyl)oxane |
| SMILES | COCOc1ccc([C@H]2C[C@H](OCOC)C[C@@H](CCOCc3ccccc3)O2)cc1OC |
| InChI | InChI=1S/C25H34O7/c1-26-17-30-22-14-21(11-12-29-16-19-7-5-4-6-8-19)32-24(15-22)20-9-10-23(31-18-27-2)25(13-20)28-3/h4-10,13,21-22,24H,11-12,14-18H2,1-3H3/t21-,22-,24-/m1/s1 |
| InChIKey | VILGASAUZCIEPB-CQOQZXRMSA-N |
| XLogP | 4.49 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|