C13H18O — CID 158778090
2-[(1R)-2-methylcyclopropyl]ethoxymethylbenzene (PubChem CID 158778090) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-[(1R)-2-methylcyclopropyl]ethoxymethylbenzene.
| Compound Name | 2-[(1R)-2-methylcyclopropyl]ethoxymethylbenzene |
|---|---|
| PubChem CID | 158778090 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-[(1R)-2-methylcyclopropyl]ethoxymethylbenzene |
| SMILES | CC1C[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-11-9-13(11)7-8-14-10-12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3/t11?,13-/m0/s1 |
| InChIKey | WTWPARPRTQNQCX-YUZLPWPTSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|