C20H34N2O — CID 129015804
N'-ethyl-N-methyl-N'-[[2-methyl-3-(2-phenylmethoxyethyl)cyclobutyl]methyl]ethane-1,2-diamine (PubChem CID 129015804) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-[[2-methyl-3-(2-phenylmethoxyethyl)cyclobutyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-[[2-methyl-3-(2-phenylmethoxyethyl)cyclobutyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 129015804 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | N'-ethyl-N-methyl-N'-[[2-methyl-3-(2-phenylmethoxyethyl)cyclobutyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CCNC)CC1CC(CCOCc2ccccc2)C1C |
| InChI | InChI=1S/C20H34N2O/c1-4-22(12-11-21-3)15-20-14-19(17(20)2)10-13-23-16-18-8-6-5-7-9-18/h5-9,17,19-21H,4,10-16H2,1-3H3 |
| InChIKey | NMANGPZQQJJNOZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|