C29H40O6 — CID 11799077
(2S,3S,4S,8S,9S,10S)-4,10-dimethyl-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-3,9-diol (PubChem CID 11799077) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is (2S,3S,4S,8S,9S,10S)-4,10-dimethyl-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-3,9-diol.
| Compound Name | (2S,3S,4S,8S,9S,10S)-4,10-dimethyl-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-3,9-diol |
|---|---|
| PubChem CID | 11799077 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (2S,3S,4S,8S,9S,10S)-4,10-dimethyl-2,8-bis(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecane-3,9-diol |
| SMILES | C[C@H]1CC2(C[C@H](C)[C@H](O)[C@H](CCOCc3ccccc3)O2)O[C@@H](CCOCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C29H40O6/c1-21-17-29(34-25(27(21)30)13-15-32-19-23-9-5-3-6-10-23)18-22(2)28(31)26(35-29)14-16-33-20-24-11-7-4-8-12-24/h3-12,21-22,25-28,30-31H,13-20H2,1-2H3/t21-,22-,25-,26-,27-,28-,29?/m0/s1 |
| InChIKey | FUYGRRZKCQSMIN-TWBXOLNTSA-N |
| XLogP | 4.47 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|