C17H22O6 — CID 135013218
2-O-benzyl 1-O-methyl (1S,2R,4R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylate (PubChem CID 135013218) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-O-benzyl 1-O-methyl (1S,2R,4R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-methyl (1S,2R,4R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135013218 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-O-benzyl 1-O-methyl (1S,2R,4R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylate |
| SMILES | COCO[C@@H]1C[C@H](C(=O)OC)[C@H](C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H22O6/c1-20-11-23-13-8-14(16(18)21-2)15(9-13)17(19)22-10-12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3/t13-,14+,15-/m1/s1 |
| InChIKey | VQDBJTPJKILCNZ-QLFBSQMISA-N |
| XLogP | 1.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|