C15H16O6 — CID 58431276
3-O-benzyl 2-O-methyl (2S,3S)-5-formyloxolane-2,3-dicarboxylate (PubChem CID 58431276) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-O-benzyl 2-O-methyl (2S,3S)-5-formyloxolane-2,3-dicarboxylate.
| Compound Name | 3-O-benzyl 2-O-methyl (2S,3S)-5-formyloxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 58431276 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-O-benzyl 2-O-methyl (2S,3S)-5-formyloxolane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1OC(C=O)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16O6/c1-19-15(18)13-12(7-11(8-16)21-13)14(17)20-9-10-5-3-2-4-6-10/h2-6,8,11-13H,7,9H2,1H3/t11?,12-,13-/m0/s1 |
| InChIKey | YRLVUUITFYNLEG-SPOOISQMSA-N |
| XLogP | 0.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|