C19H27NO8 — CID 11795088
(2R,4S,6S)-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (PubChem CID 11795088) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is (2R,4S,6S)-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid.
| Compound Name | (2R,4S,6S)-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11795088 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (2R,4S,6S)-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| SMILES | COCOC[C@@H]1C[C@H](OCOC)C[C@H](C(=O)O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO8/c1-24-12-26-11-15-8-16(28-13-25-2)9-17(18(21)22)20(15)19(23)27-10-14-6-4-3-5-7-14/h3-7,15-17H,8-13H2,1-2H3,(H,21,22)/t15-,16-,17+/m0/s1 |
| InChIKey | YVGNJMDHXLMXNY-YESZJQIVSA-N |
| XLogP | 1.85 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|