C24H27NO7 — CID 14629884
1-O-benzyl 2-O-methyl (2S,4S,5R)-4-acetyloxy-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 14629884) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,4S,5R)-4-acetyloxy-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,4S,5R)-4-acetyloxy-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14629884 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,4S,5R)-4-acetyloxy-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)[C@@H](COCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO7/c1-17(26)32-22-13-20(23(27)29-2)25(24(28)31-15-19-11-7-4-8-12-19)21(22)16-30-14-18-9-5-3-6-10-18/h3-12,20-22H,13-16H2,1-2H3/t20-,21+,22-/m0/s1 |
| InChIKey | WDDIPJJZUFHNBR-BDTNDASRSA-N |
| XLogP | 3.09 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|