C26H34N2O10 — CID 173484291
1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-acetyloxy-5-[(E)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)but-2-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 173484291) has the molecular formula C26H34N2O10 and a molecular weight of 534.56 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-acetyloxy-5-[(E)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)but-2-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-acetyloxy-5-[(E)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)but-2-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 173484291 |
| Molecular Formula | C26H34N2O10 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-acetyloxy-5-[(E)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)but-2-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)/C(=C\C[C@H]1[C@H](OC(C)=O)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O10/c1-16(29)37-21-14-20(23(31)35-6)28(25(33)38-26(2,3)4)19(21)13-12-18(22(30)34-5)27-24(32)36-15-17-10-8-7-9-11-17/h7-12,19-21H,13-15H2,1-6H3,(H,27,32)/b18-12+/t19-,20-,21+/m0/s1 |
| InChIKey | JCSKWHHLMNXWPU-CFJCKFNASA-N |
| XLogP | 2.84 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|