C18H23NO4 — CID 58818860
methyl (2Z)-5,5-dimethyl-2-(phenylmethoxycarbonylamino)hepta-2,6-dienoate (PubChem CID 58818860) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is methyl (2Z)-5,5-dimethyl-2-(phenylmethoxycarbonylamino)hepta-2,6-dienoate.
| Compound Name | methyl (2Z)-5,5-dimethyl-2-(phenylmethoxycarbonylamino)hepta-2,6-dienoate |
|---|---|
| PubChem CID | 58818860 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl (2Z)-5,5-dimethyl-2-(phenylmethoxycarbonylamino)hepta-2,6-dienoate |
| SMILES | C=CC(C)(C)C/C=C(\NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H23NO4/c1-5-18(2,3)12-11-15(16(20)22-4)19-17(21)23-13-14-9-7-6-8-10-14/h5-11H,1,12-13H2,2-4H3,(H,19,21)/b15-11- |
| InChIKey | BPYOEUSUUSXNKW-PTNGSMBKSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|