C17H19F2NO4 — CID 140541376
methyl (Z)-3-(3,4-difluorocyclopentyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate (PubChem CID 140541376) has the molecular formula C17H19F2NO4 and a molecular weight of 339.34 g/mol. Its IUPAC name is methyl (Z)-3-(3,4-difluorocyclopentyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate.
| Compound Name | methyl (Z)-3-(3,4-difluorocyclopentyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 140541376 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl (Z)-3-(3,4-difluorocyclopentyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate |
| SMILES | COC(=O)/C(=C/C1CC(F)C(F)C1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19F2NO4/c1-23-16(21)15(9-12-7-13(18)14(19)8-12)20-17(22)24-10-11-5-3-2-4-6-11/h2-6,9,12-14H,7-8,10H2,1H3,(H,20,22)/b15-9- |
| InChIKey | SGAKFQGGFAYKMR-DHDCSXOGSA-N |
| XLogP | 3.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|