C16H19NO6 — CID 15125985
dimethyl (E)-2-(phenylmethoxycarbonylamino)hex-2-enedioate (PubChem CID 15125985) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is dimethyl (E)-2-(phenylmethoxycarbonylamino)hex-2-enedioate.
| Compound Name | dimethyl (E)-2-(phenylmethoxycarbonylamino)hex-2-enedioate |
|---|---|
| PubChem CID | 15125985 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | dimethyl (E)-2-(phenylmethoxycarbonylamino)hex-2-enedioate |
| SMILES | COC(=O)CC/C=C(/NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H19NO6/c1-21-14(18)10-6-9-13(15(19)22-2)17-16(20)23-11-12-7-4-3-5-8-12/h3-5,7-9H,6,10-11H2,1-2H3,(H,17,20)/b13-9+ |
| InChIKey | BGCWTLPZDMKZEG-UKTHLTGXSA-N |
| XLogP | 1.92 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|