C17H15FN2O4 — CID 118470031
methyl (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate (PubChem CID 118470031) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate.
| Compound Name | methyl (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 118470031 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(F)cn1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O4/c1-23-16(21)15(9-14-8-7-13(18)10-19-14)20-17(22)24-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,22)/b15-9- |
| InChIKey | LGOFPUJGVHAISL-DHDCSXOGSA-N |
| XLogP | 2.66 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|