C23H20N2O4 — CID 154701023
methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)prop-2-enoate (PubChem CID 154701023) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)prop-2-enoate.
| Compound Name | methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 154701023 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(-c2ccccc2)nc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H20N2O4/c1-28-22(26)21(25-23(27)29-16-17-8-4-2-5-9-17)14-18-12-13-20(24-15-18)19-10-6-3-7-11-19/h2-15H,16H2,1H3,(H,25,27)/b21-14- |
| InChIKey | MSXWDNLALSUTJV-STZFKDTASA-N |
| XLogP | 4.19 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|