C34H29N3O4 — CID 10951677
methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)prop-2-enoate (PubChem CID 10951677) has the molecular formula C34H29N3O4 and a molecular weight of 543.62 g/mol. Its IUPAC name is methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)prop-2-enoate.
| Compound Name | methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10951677 |
| Molecular Formula | C34H29N3O4 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | methyl (Z)-2-(phenylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H29N3O4/c1-40-32(38)31(36-33(39)41-24-26-14-6-2-7-15-26)22-30-23-37(25-35-30)34(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-23,25H,24H2,1H3,(H,36,39)/b31-22- |
| InChIKey | ZMHWRHPPVOOUQV-VAMRJTSQSA-N |
| XLogP | 6.16 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|