C16H13FN2O4 — CID 126568037
(Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid (PubChem CID 126568037) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid.
| Compound Name | (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 126568037 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (Z)-3-(5-fluoro-2-pyridinyl)-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
| SMILES | O=C(N/C(=C\c1ccc(F)cn1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C16H13FN2O4/c17-12-6-7-13(18-9-12)8-14(15(20)21)19-16(22)23-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,19,22)(H,20,21)/b14-8- |
| InChIKey | COTFHEIQSOCLEQ-ZSOIEALJSA-N |
| XLogP | 2.57 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|