C13H15NO6P+ — CID 71087261
[(Z)-3-carboxy-3-(phenylmethoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium (PubChem CID 71087261) has the molecular formula C13H15NO6P+ and a molecular weight of 312.24 g/mol. Its IUPAC name is [(Z)-3-carboxy-3-(phenylmethoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium.
| Compound Name | [(Z)-3-carboxy-3-(phenylmethoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium |
|---|---|
| PubChem CID | 71087261 |
| Molecular Formula | C13H15NO6P+ |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [(Z)-3-carboxy-3-(phenylmethoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium |
| SMILES | O=C(N/C(=C\C[P+](=O)CO)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C13H14NO6P/c15-9-21(19)7-6-11(12(16)17)14-13(18)20-8-10-4-2-1-3-5-10/h1-6,15H,7-9H2,(H-,14,16,17,18)/p+1/b11-6- |
| InChIKey | FSMXVPNACQUGPT-WDZFZDKYSA-O |
| XLogP | 1.66 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|