C50H55NO11 — CID 102021266
benzyl (2R,3R,4S,5S)-5-acetyloxy-3-hydroxy-4-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(phenylmethoxymethyl)piperidine-1-carboxylate (PubChem CID 102021266) has the molecular formula C50H55NO11 and a molecular weight of 845.99 g/mol. Its IUPAC name is benzyl (2R,3R,4S,5S)-5-acetyloxy-3-hydroxy-4-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(phenylmethoxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4S,5S)-5-acetyloxy-3-hydroxy-4-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(phenylmethoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102021266 |
| Molecular Formula | C50H55NO11 |
| Molecular Weight | 845.99 g/mol |
| Exact Mass | 845.38 |
| IUPAC Name | benzyl (2R,3R,4S,5S)-5-acetyloxy-3-hydroxy-4-[(2R,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(phenylmethoxymethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)O[C@H]1CN(C(=O)OCc2ccccc2)[C@H](COCc2ccccc2)[C@@H](O)[C@@H]1O[C@H]1O[C@H](C)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C50H55NO11/c1-35-45(56-30-38-20-10-4-11-21-38)47(57-31-39-22-12-5-13-23-39)48(58-32-40-24-14-6-15-25-40)49(60-35)62-46-43(61-36(2)52)28-51(50(54)59-33-41-26-16-7-17-27-41)42(44(46)53)34-55-29-37-18-8-3-9-19-37/h3-27,35,42-49,53H,28-34H2,1-2H3/t35-,42-,43+,44-,45+,46-,47+,48-,49-/m1/s1 |
| InChIKey | JFTVOULCVMLJKE-ZJCWILHUSA-N |
| XLogP | 7.40 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.99 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |