C24H36O5 — CID 10862358
ethyl (1R,2S,4S)-4-(methoxymethoxy)-2-[(E,6S)-6-phenylmethoxyhept-1-enyl]cyclopentane-1-carboxylate (PubChem CID 10862358) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-4-(methoxymethoxy)-2-[(E,6S)-6-phenylmethoxyhept-1-enyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-4-(methoxymethoxy)-2-[(E,6S)-6-phenylmethoxyhept-1-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10862358 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | ethyl (1R,2S,4S)-4-(methoxymethoxy)-2-[(E,6S)-6-phenylmethoxyhept-1-enyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](OCOC)C[C@H]1/C=C/CCC[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C24H36O5/c1-4-27-24(25)23-16-22(29-18-26-3)15-21(23)14-10-5-7-11-19(2)28-17-20-12-8-6-9-13-20/h6,8-10,12-14,19,21-23H,4-5,7,11,15-18H2,1-3H3/b14-10+/t19-,21+,22-,23+/m0/s1 |
| InChIKey | XEEPNDCIGBKWRM-SZAZLMKGSA-N |
| XLogP | 4.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|