C29H40O7 — CID 10885595
methyl (E,2S,6R,10S)-2-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-10-phenylmethoxyundec-4-enoate (PubChem CID 10885595) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is methyl (E,2S,6R,10S)-2-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-10-phenylmethoxyundec-4-enoate.
| Compound Name | methyl (E,2S,6R,10S)-2-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-10-phenylmethoxyundec-4-enoate |
|---|---|
| PubChem CID | 10885595 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | methyl (E,2S,6R,10S)-2-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-10-phenylmethoxyundec-4-enoate |
| SMILES | COCO[C@@H](C/C=C/[C@@H](CCC[C@H](C)OCc1ccccc1)OCc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C29H40O7/c1-23(34-20-24-11-6-5-7-12-24)10-8-13-27(35-21-25-16-18-26(32-3)19-17-25)14-9-15-28(29(30)33-4)36-22-31-2/h5-7,9,11-12,14,16-19,23,27-28H,8,10,13,15,20-22H2,1-4H3/b14-9+/t23-,27+,28-/m0/s1 |
| InChIKey | VUFSQHGJQZBLKA-ZPHJJVGBSA-N |
| XLogP | 5.46 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|