C24H42O5Si — CID 11732882
methyl (2S,9R)-2-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)decanoate (PubChem CID 11732882) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is methyl (2S,9R)-2-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)decanoate.
| Compound Name | methyl (2S,9R)-2-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)decanoate |
|---|---|
| PubChem CID | 11732882 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | methyl (2S,9R)-2-phenylmethoxy-9-(2-trimethylsilylethoxymethoxy)decanoate |
| SMILES | COC(=O)[C@H](CCCCCC[C@@H](C)OCOCC[Si](C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C24H42O5Si/c1-21(29-20-27-17-18-30(3,4)5)13-9-6-7-12-16-23(24(25)26-2)28-19-22-14-10-8-11-15-22/h8,10-11,14-15,21,23H,6-7,9,12-13,16-20H2,1-5H3/t21-,23+/m1/s1 |
| InChIKey | VVEVRHRDZRIVAA-GGAORHGYSA-N |
| XLogP | 5.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|