C21H35NO6SSi — CID 102463299
(2S,3R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxymethoxy)butanoic acid (PubChem CID 102463299) has the molecular formula C21H35NO6SSi and a molecular weight of 457.67 g/mol. Its IUPAC name is (2S,3R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxymethoxy)butanoic acid.
| Compound Name | (2S,3R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxymethoxy)butanoic acid |
|---|---|
| PubChem CID | 102463299 |
| Molecular Formula | C21H35NO6SSi |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (2S,3R)-2-(2-methylsulfanylethyl)-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxymethoxy)butanoic acid |
| SMILES | CSCC[C@@](NC(=O)OCc1ccccc1)(C(=O)O)[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C21H35NO6SSi/c1-17(28-16-26-12-14-30(3,4)5)21(19(23)24,11-13-29-2)22-20(25)27-15-18-9-7-6-8-10-18/h6-10,17H,11-16H2,1-5H3,(H,22,25)(H,23,24)/t17-,21+/m1/s1 |
| InChIKey | KXQANVMVAZJMCO-UTKZUKDTSA-N |
| XLogP | 4.21 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|