C23H35O5Si- — CID 57372725
(3S,7R)-3-ethenyl-2-phenylmethoxy-7-(2-trimethylsilylethoxymethoxy)oct-5-enoate (PubChem CID 57372725) has the molecular formula C23H35O5Si- and a molecular weight of 419.61 g/mol. Its IUPAC name is (3S,7R)-3-ethenyl-2-phenylmethoxy-7-(2-trimethylsilylethoxymethoxy)oct-5-enoate.
| Compound Name | (3S,7R)-3-ethenyl-2-phenylmethoxy-7-(2-trimethylsilylethoxymethoxy)oct-5-enoate |
|---|---|
| PubChem CID | 57372725 |
| Molecular Formula | C23H35O5Si- |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (3S,7R)-3-ethenyl-2-phenylmethoxy-7-(2-trimethylsilylethoxymethoxy)oct-5-enoate |
| SMILES | C=C[C@H](CC=C[C@@H](C)OCOCC[Si](C)(C)C)C(OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C23H36O5Si/c1-6-21(22(23(24)25)27-17-20-12-8-7-9-13-20)14-10-11-19(2)28-18-26-15-16-29(3,4)5/h6-13,19,21-22H,1,14-18H2,2-5H3,(H,24,25)/p-1/t19-,21-,22?/m1/s1 |
| InChIKey | JUQMZQBIKCQHHZ-ZJBPFHOOSA-M |
| XLogP | 3.79 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|