C16H24O2 — CID 14764351
(Z,4R,8S)-8-phenylmethoxynon-6-en-4-ol (PubChem CID 14764351) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (Z,4R,8S)-8-phenylmethoxynon-6-en-4-ol.
| Compound Name | (Z,4R,8S)-8-phenylmethoxynon-6-en-4-ol |
|---|---|
| PubChem CID | 14764351 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (Z,4R,8S)-8-phenylmethoxynon-6-en-4-ol |
| SMILES | CCC[C@@H](O)C/C=C\[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-3-8-16(17)12-7-9-14(2)18-13-15-10-5-4-6-11-15/h4-7,9-11,14,16-17H,3,8,12-13H2,1-2H3/b9-7-/t14-,16+/m0/s1 |
| InChIKey | LNSAUCXXSFOSSQ-CMWWXKBXSA-N |
| XLogP | 3.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|