C17H20O3 — CID 14764349
(Z,1R,5S)-1-(furan-2-yl)-5-phenylmethoxyhex-3-en-1-ol (PubChem CID 14764349) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (Z,1R,5S)-1-(furan-2-yl)-5-phenylmethoxyhex-3-en-1-ol.
| Compound Name | (Z,1R,5S)-1-(furan-2-yl)-5-phenylmethoxyhex-3-en-1-ol |
|---|---|
| PubChem CID | 14764349 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (Z,1R,5S)-1-(furan-2-yl)-5-phenylmethoxyhex-3-en-1-ol |
| SMILES | C[C@@H](/C=C\C[C@@H](O)c1ccco1)OCc1ccccc1 |
| InChI | InChI=1S/C17H20O3/c1-14(20-13-15-8-3-2-4-9-15)7-5-10-16(18)17-11-6-12-19-17/h2-9,11-12,14,16,18H,10,13H2,1H3/b7-5-/t14-,16+/m0/s1 |
| InChIKey | ZVWBTXPJCNODES-VKDHPCIHSA-N |
| XLogP | 3.86 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|