C19H24O2 — CID 10731799
2-[(Z,4R)-4-phenylmethoxyoct-1-enyl]furan (PubChem CID 10731799) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[(Z,4R)-4-phenylmethoxyoct-1-enyl]furan.
| Compound Name | 2-[(Z,4R)-4-phenylmethoxyoct-1-enyl]furan |
|---|---|
| PubChem CID | 10731799 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-[(Z,4R)-4-phenylmethoxyoct-1-enyl]furan |
| SMILES | CCCC[C@H](C/C=C\c1ccco1)OCc1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-2-3-11-19(13-7-12-18-14-8-15-20-18)21-16-17-9-5-4-6-10-17/h4-10,12,14-15,19H,2-3,11,13,16H2,1H3/b12-7-/t19-/m1/s1 |
| InChIKey | ORROXCNEPUYZON-XCJXAGMVSA-N |
| XLogP | 5.46 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |