C19H30O3 — CID 15372294
(E,4S,8R)-8-phenylmethoxydodec-5-ene-1,4-diol (PubChem CID 15372294) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (E,4S,8R)-8-phenylmethoxydodec-5-ene-1,4-diol.
| Compound Name | (E,4S,8R)-8-phenylmethoxydodec-5-ene-1,4-diol |
|---|---|
| PubChem CID | 15372294 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (E,4S,8R)-8-phenylmethoxydodec-5-ene-1,4-diol |
| SMILES | CCCC[C@H](C/C=C/[C@@H](O)CCCO)OCc1ccccc1 |
| InChI | InChI=1S/C19H30O3/c1-2-3-13-19(14-7-11-18(21)12-8-15-20)22-16-17-9-5-4-6-10-17/h4-7,9-11,18-21H,2-3,8,12-16H2,1H3/b11-7+/t18-,19-/m1/s1 |
| InChIKey | SZJURUYDXRVLTD-BLRGSVSVSA-N |
| XLogP | 3.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|