C19H28O2 — CID 10880742
(3S,5Z,7R)-2-methyl-7-phenylmethoxyundeca-5,10-dien-3-ol (PubChem CID 10880742) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3S,5Z,7R)-2-methyl-7-phenylmethoxyundeca-5,10-dien-3-ol.
| Compound Name | (3S,5Z,7R)-2-methyl-7-phenylmethoxyundeca-5,10-dien-3-ol |
|---|---|
| PubChem CID | 10880742 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3S,5Z,7R)-2-methyl-7-phenylmethoxyundeca-5,10-dien-3-ol |
| SMILES | C=CCC[C@H](/C=C\C[C@H](O)C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-4-5-12-18(13-9-14-19(20)16(2)3)21-15-17-10-7-6-8-11-17/h4,6-11,13,16,18-20H,1,5,12,14-15H2,2-3H3/b13-9-/t18-,19+/m1/s1 |
| InChIKey | JMAWOVUMOGECBI-SHDPZIPESA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|