C19H28O2 — CID 11150405
(3Z,5E,7S)-7-phenylmethoxydodeca-3,5-dien-1-ol (PubChem CID 11150405) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3Z,5E,7S)-7-phenylmethoxydodeca-3,5-dien-1-ol.
| Compound Name | (3Z,5E,7S)-7-phenylmethoxydodeca-3,5-dien-1-ol |
|---|---|
| PubChem CID | 11150405 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3Z,5E,7S)-7-phenylmethoxydodeca-3,5-dien-1-ol |
| SMILES | CCCCC[C@@H](/C=C/C=C\CCO)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-2-3-7-14-19(15-10-4-5-11-16-20)21-17-18-12-8-6-9-13-18/h4-6,8-10,12-13,15,19-20H,2-3,7,11,14,16-17H2,1H3/b5-4-,15-10+/t19-/m0/s1 |
| InChIKey | BQPPCSMZFFLLDN-LKYODJDHSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|