C29H38O3 — CID 86746684
(4R,5S,8S)-5-ethenyl-4,8-bis(phenylmethoxy)tridec-6-enal (PubChem CID 86746684) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is (4R,5S,8S)-5-ethenyl-4,8-bis(phenylmethoxy)tridec-6-enal.
| Compound Name | (4R,5S,8S)-5-ethenyl-4,8-bis(phenylmethoxy)tridec-6-enal |
|---|---|
| PubChem CID | 86746684 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (4R,5S,8S)-5-ethenyl-4,8-bis(phenylmethoxy)tridec-6-enal |
| SMILES | C=C[C@@H](C=C[C@H](CCCCC)OCc1ccccc1)[C@@H](CCC=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H38O3/c1-3-5-8-18-28(31-23-25-14-9-6-10-15-25)21-20-27(4-2)29(19-13-22-30)32-24-26-16-11-7-12-17-26/h4,6-7,9-12,14-17,20-22,27-29H,2-3,5,8,13,18-19,23-24H2,1H3/t27-,28-,29+/m0/s1 |
| InChIKey | BTINHAPXJLPEHT-YTCPBCGMSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|