C30H44O5 — CID 11145338
(E,3S,6S)-3-[(1R)-3,3-dimethoxy-1-phenylmethoxypropyl]-6-phenylmethoxyundec-4-en-1-ol (PubChem CID 11145338) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (E,3S,6S)-3-[(1R)-3,3-dimethoxy-1-phenylmethoxypropyl]-6-phenylmethoxyundec-4-en-1-ol.
| Compound Name | (E,3S,6S)-3-[(1R)-3,3-dimethoxy-1-phenylmethoxypropyl]-6-phenylmethoxyundec-4-en-1-ol |
|---|---|
| PubChem CID | 11145338 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (E,3S,6S)-3-[(1R)-3,3-dimethoxy-1-phenylmethoxypropyl]-6-phenylmethoxyundec-4-en-1-ol |
| SMILES | CCCCC[C@@H](/C=C/[C@H](CCO)[C@@H](CC(OC)OC)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H44O5/c1-4-5-8-17-28(34-23-25-13-9-6-10-14-25)19-18-27(20-21-31)29(22-30(32-2)33-3)35-24-26-15-11-7-12-16-26/h6-7,9-16,18-19,27-31H,4-5,8,17,20-24H2,1-3H3/b19-18+/t27-,28+,29-/m1/s1 |
| InChIKey | ONAUSIUIJDKKQO-WBAYMCKCSA-N |
| XLogP | 6.30 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|