C26H34O3 — CID 102264059
(Z,5R,9S)-10-methyl-5,9-bis(phenylmethoxy)undec-6-enal (PubChem CID 102264059) has the molecular formula C26H34O3 and a molecular weight of 394.55 g/mol. Its IUPAC name is (Z,5R,9S)-10-methyl-5,9-bis(phenylmethoxy)undec-6-enal.
| Compound Name | (Z,5R,9S)-10-methyl-5,9-bis(phenylmethoxy)undec-6-enal |
|---|---|
| PubChem CID | 102264059 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (Z,5R,9S)-10-methyl-5,9-bis(phenylmethoxy)undec-6-enal |
| SMILES | CC(C)[C@H](C/C=C\[C@@H](CCCC=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H34O3/c1-22(2)26(29-21-24-14-7-4-8-15-24)18-11-17-25(16-9-10-19-27)28-20-23-12-5-3-6-13-23/h3-8,11-15,17,19,22,25-26H,9-10,16,18,20-21H2,1-2H3/b17-11-/t25-,26+/m1/s1 |
| InChIKey | SMWRTRRQVBHBCK-SJJGMTDFSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|