C15H20O3 — CID 71665399
(5R)-5-[(4-methoxyphenyl)methoxy]hept-6-enal (PubChem CID 71665399) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (5R)-5-[(4-methoxyphenyl)methoxy]hept-6-enal.
| Compound Name | (5R)-5-[(4-methoxyphenyl)methoxy]hept-6-enal |
|---|---|
| PubChem CID | 71665399 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (5R)-5-[(4-methoxyphenyl)methoxy]hept-6-enal |
| SMILES | C=C[C@@H](CCCC=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O3/c1-3-14(6-4-5-11-16)18-12-13-7-9-15(17-2)10-8-13/h3,7-11,14H,1,4-6,12H2,2H3/t14-/m0/s1 |
| InChIKey | KPXRWMYEWYXHGU-AWEZNQCLSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|