C18H24O4 — CID 54672585
(5Z,8R)-8-[(4-methoxyphenyl)methoxy]deca-5,9-dienoic acid (PubChem CID 54672585) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (5Z,8R)-8-[(4-methoxyphenyl)methoxy]deca-5,9-dienoic acid.
| Compound Name | (5Z,8R)-8-[(4-methoxyphenyl)methoxy]deca-5,9-dienoic acid |
|---|---|
| PubChem CID | 54672585 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (5Z,8R)-8-[(4-methoxyphenyl)methoxy]deca-5,9-dienoic acid |
| SMILES | C=C[C@@H](C/C=C\CCCC(=O)O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24O4/c1-3-16(8-6-4-5-7-9-18(19)20)22-14-15-10-12-17(21-2)13-11-15/h3-4,6,10-13,16H,1,5,7-9,14H2,2H3,(H,19,20)/b6-4-/t16-/m0/s1 |
| InChIKey | XAOVQVBVQALHAH-LEXSJLIMSA-N |
| XLogP | 3.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|